BD1480448
2-(4-(Dimethylamino)styryl)-1-ethylpyridin-1-iumiodide , 98+% , 3785-01-1
Synonym(s):
DASPEI
CAS NO.：3785-01-1
Empirical Formula: C17H21IN2
Molecular Weight: 380.27
MDL number: MFCD00011994
EINECS: 223-248-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB623.20 | In Stock |
|
| 250mg | RMB934.40 | In Stock |
|
| 1g | RMB2332.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 267 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | methanol: soluble |
| form | solid |
| color | red |
| Sensitive | Light Sensitive |
| λmax | 461 nm |
| Biological Applications | Detecting prostate cancer; drug screening assays; treating amyloidosis disorder |
| Major Application | Color proofing materials;holographic materials;monitoring photopolymerizationprocesses;platemaking materials;optoelectronicdevices;photographic materials/systems;photoresists;thermal cure monitoring of phenolicresole resins |
| InChI | 1S/C17H21N2.HI/c1-4-19-14-6-5-7-17(19)13-10-15-8-11-16(12-9-15)18(2)3;/h5-14H,4H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | AMAXNNVXIBDEMV-UHFFFAOYSA-M |
| SMILES | [I-].CC[n+]1ccccc1\C=C\c2ccc(cc2)N(C)C |
| EPA Substance Registry System | Pyridinium, 2-[2-[4-(dimethylamino)phenyl]ethenyl]-1-ethyl-, iodide (3785-01-1) |
Description and Uses
2-[4-(Dimethylamino)styryl]-1-ethylpyridinium iodide (DASPEI) has been used for the labelling of hair cells in larval zebrafish.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | UU3971000 |
| F | 8-10 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
