BD1491032
5-Chloropyrimidin-2(1H)-one , 98% , 54326-16-8
CAS NO.：54326-16-8
Empirical Formula: C4H3ClN2O
Molecular Weight: 130.53
MDL number: MFCD00129723
EINECS: 259-106-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB60.80 | In Stock |
|
| 1g | RMB152.80 | In Stock |
|
| 5g | RMB549.60 | In Stock |
|
| 25g | RMB2196.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 237-238 °C (decomp) |
| Density | 1.55±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 7.62±0.10(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C4H3ClN2O/c5-3-1-6-4(8)7-2-3/h1-2H,(H,6,7,8) |
| InChIKey | OCSYCDVQABSEPJ-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C(Cl)C=N1 |
| CAS DataBase Reference | 54326-16-8(CAS DataBase Reference) |
| EPA Substance Registry System | 2(1H)-Pyrimidinone, 5-chloro- (54326-16-8) |
Description and Uses
5-?Chloro-?2-?hydroxypyrimidine is used to prepare dimethoxy-pyrrolidylquinazolines as brain penetrable PDE10A inhibitors. It is also used in the synthesis of platinum(II) hydroxypyrimidinato ethylenediamine tetranuclear metallacalix[4]arene complexes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| HS Code | 2933599590 |
