BD1493932
4'-Amino-[1,1'-biphenyl]-4-carboxylic acid , 95% , 5730-78-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB129.60 | In Stock |
|
| 250mg | RMB161.60 | In Stock |
|
| 1g | RMB503.20 | In Stock |
|
| 5g | RMB1704.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 227-236℃ |
| Boiling point: | 421.1±28.0 °C(Predicted) |
| Density | 1.257 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 4.42±0.10(Predicted) |
| form | solid |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C13H11NO2/c14-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(15)16/h1-8H,14H2,(H,15,16) |
| InChIKey | ZSFKODANZQVHCK-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(N)C=C2)=CC=C(C(O)=O)C=C1 |
Description and Uses
4-Aminobiphenyl-4''-carboxylic Acid, is an building block that can be used for the synthesis of Biphenyl and biphenyl ether compounds, that block DNA binding of the Human Papillomavirus (HPVs) E2 Protein, and thus can be used for the development of antiviral agents that interfere with HPV replication.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P260-P271 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HS Code | 2921420090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |

![4'-Amino-[1,1'-biphenyl]-4-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/5730-78-9.gif)


![Methyl 4'-amino-[1,1'-biphenyl]-4-carboxylate](https://img.chemicalbook.com/CAS/GIF/5730-76-7.gif)
![4'-Nitro-[1,1'-biphenyl]-4-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/92-89-7.gif)
![Methyl 4'-nitro-[1,1'-biphenyl]-4-carboxylate](https://img.chemicalbook.com/CAS/GIF/5730-75-6.gif)