BD1507732
4-Bromo-2-(trifluoromethyl)pyridine , 98% , 887583-90-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB92.80 | In Stock |
|
| 5g | RMB314.40 | In Stock |
|
| 10g | RMB610.40 | In Stock |
|
| 25g | RMB1404.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 167.4±35.0 °C(Predicted) |
| Density | 1.707±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pka | -1.23±0.10(Predicted) |
| form | liquid |
| color | Colourless |
| InChI | InChI=1S/C6H3BrF3N/c7-4-1-2-11-5(3-4)6(8,9)10/h1-3H |
| InChIKey | QHLLEZOPZRBCOY-UHFFFAOYSA-N |
| SMILES | C1(C(F)(F)F)=NC=CC(Br)=C1 |
Description and Uses
4-Bromo-2-(trifluoromethyl)pyridine is used in the synthesis of a potent and selective Class IIa histone deacetylase inhibitors as a potential therapy for Huntington’s disease.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P280-P271 |
| HS Code | 2933399990 |
