BD1514532
2-Amino-4,6-dichloropyrimidine-5-carbaldehyde , 95% , 5604-46-6
CAS NO.:5604-46-6
Empirical Formula: C5H3Cl2N3O
Molecular Weight: 192
MDL number: MFCD03001242
EINECS: 624-720-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB33.60 | In Stock |
|
| 5g | RMB80.80 | In Stock |
|
| 10g | RMB156.80 | In Stock |
|
| 25g | RMB281.60 | In Stock |
|
| 100g | RMB1111.20 | In Stock |
|
| 500g | RMB3544.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208-224 °C |
| Boiling point: | 411.6±55.0 °C(Predicted) |
| Density | 1.688±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder |
| pka | -1.57±0.10(Predicted) |
| color | Pale Yellow |
| Sensitive | Air Sensitive |
| InChI | 1S/C5H3Cl2N3O/c6-3-2(1-11)4(7)10-5(8)9-3/h1H,(H2,8,9,10) |
| InChIKey | GOJUJUVQIVIZAV-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1c(Cl)nc(N)nc1Cl |
| CAS DataBase Reference | 5604-46-6(CAS DataBase Reference) |
Description and Uses
Substrate used in the synthesis of an N-terminal surrogate in amino acid and peptide analogues.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-43 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |






