BD1520432
4-Chloro-2-(trifluoromethyl)pyrimidine , 95% , 1514-96-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB151.20 | In Stock |
|
| 250mg | RMB254.40 | In Stock |
|
| 1g | RMB411.20 | In Stock |
|
| 5g | RMB1235.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 115.4±40.0 °C(Predicted) |
| Density | 1.504g/ml |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | -3.28±0.20(Predicted) |
| form | Oil |
| color | Clear Colourless |
| InChI | InChI=1S/C5H2ClF3N2/c6-3-1-2-10-4(11-3)5(7,8)9/h1-2H |
| InChIKey | OVEGSCLVOXWLIV-UHFFFAOYSA-N |
| SMILES | C1(C(F)(F)F)=NC=CC(Cl)=N1 |
Description and Uses
4-Chloro-2-(trifluoromethyl)pyrimidine is used to prepare trifluoromethyl(pyrimidin-??2-??yl)??azetidine-??2-??carboxamides as potent, orally bioavailable TGR5 (GPBAR1) agonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H226-H302-H312-H332-H315 |
| Precautionary statements | P261-P271-P280 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
