BD1533132
4-Chlorophenylacetone , 98% , 5586-88-9
CAS NO.：5586-88-9
Empirical Formula: C9H9ClO
Molecular Weight: 168.62
MDL number: MFCD00045214
EINECS: 226-986-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB59.20 | In Stock |
|
| 10g | RMB109.60 | In Stock |
|
| 25g | RMB218.40 | In Stock |
|
| 100g | RMB616.00 | In Stock |
|
| 500g | RMB2108.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 6-8 °C |
| Boiling point: | 132 °C |
| Density | 1.151 |
| refractive index | 1.5325-1.5345 |
| Flash point: | >110℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Clear light yellow |
| InChI | 1S/C9H9ClO/c1-7(11)6-8-2-4-9(10)5-3-8/h2-5H,6H2,1H3 |
| InChIKey | WEJRYKSUUFKMBC-UHFFFAOYSA-N |
| SMILES | CC(=O)Cc1ccc(Cl)cc1 |
| CAS DataBase Reference | 5586-88-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Propanone,p-chlorophenyl-(5586-88-9) |
Description and Uses
4-Chlorophenylacetone is a phenylacetone derivative used in the preparation of biologically active compounds such as anorectic agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H412 |
| Precautionary statements | P264-P270-P273-P301+P312-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22-52 |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 |
