BD1535332
4-Cyano-4-(4-fluorophenyl)cyclohexanone , 98% , 56326-98-8
CAS NO.：56326-98-8
Empirical Formula: C13H12FNO
Molecular Weight: 217.24
MDL number: MFCD00044815
EINECS: 260-111-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB306.40 | In Stock |
|
| 1g | RMB630.40 | In Stock |
|
| 5g | RMB1928.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 91-94°C |
| Boiling point: | 373.6±42.0 °C(Predicted) |
| Density | 1.19±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| Appearance | White to off-white Solid |
| InChI | 1S/C13H12FNO/c14-11-3-1-10(2-4-11)13(9-15)7-5-12(16)6-8-13/h1-4H,5-8H2 |
| InChIKey | FNWWTNNFZGBMEM-UHFFFAOYSA-N |
| SMILES | FC1=CC=C(C2(C#N)CCC(CC2)=O)C=C1 |
Description and Uses
4-Cyano-4-(4-fluorophenyl)cyclohexanone is used as a reagent in the synthesis of novel 4,4-disubstituted cyclohexylbenzamide derivatives as potent 11β-HSD1 inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| RIDADR | UN3439 |
| WGK Germany | WGK 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2926907090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
