BD1536932
Quinuclidine-4-carbonitrile , 97% , 26458-78-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB93.60 | In Stock |
|
| 250mg | RMB171.20 | In Stock |
|
| 1g | RMB431.20 | In Stock |
|
| 5g | RMB1595.20 | In Stock |
|
| 10g | RMB2557.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-130°C |
| Boiling point: | 239℃ |
| Density | 1.09 |
| Flash point: | 97℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethanol (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| pka | 8.02±0.12(Predicted) |
| color | Light Orange |
| InChI | InChI=1S/C8H12N2/c9-7-8-1-4-10(5-2-8)6-3-8/h1-6H2 |
| InChIKey | CEMKLAOKVLRABO-UHFFFAOYSA-N |
| SMILES | N12CCC(C#N)(CC1)CC2 |
Description and Uses
4-Cyanoquinuclidine is an intermediate used to prepare pleuromutilin (P610500) derivatives as antimicrobials.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331 |
| Precautionary statements | P261-P280-P301+P310-P311 |
| Hazard Codes | Xi |
| RIDADR | UN3439 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 2933998090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
