BD1549032
2-(Trifluoromethyl)quinolin-4-ol , 98% , 1701-18-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB43.20 | In Stock |
|
| 5g | RMB99.20 | In Stock |
|
| 25g | RMB490.40 | In Stock |
|
| 100g | RMB1863.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 209-211°C |
| Boiling point: | 299.1±35.0 °C(Predicted) |
| Density | 1.433±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 6.62±0.40(Predicted) |
| form | solid |
| Appearance | White to off-white Solid |
| InChI | 1S/C10H6F3NO/c11-10(12,13)9-5-8(15)6-3-1-2-4-7(6)14-9/h1-5H,(H,14,15) |
| InChIKey | SUNAMHNJYSQUPL-UHFFFAOYSA-N |
| SMILES | Oc1cc(nc2ccccc12)C(F)(F)F |
Description and Uses
4-Hydroxy-2-trifluoromethylquinoline
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-25 |
| Safety Statements | 26-37/39-45 |
| RIDADR | UN2811 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2933491090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
