A1246612
2,8-Bis(trifluoromethyl)-4-hydroxyquinoline , 99% , 35853-41-9
CAS NO.:35853-41-9
Empirical Formula: C11H5F6NO
Molecular Weight: 281.15
MDL number: MFCD00075091
EINECS: 252-762-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB34.40 | In Stock |
|
| 5G | RMB149.60 | In Stock |
|
| 25G | RMB512.00 | In Stock |
|
| 100G | RMB1339.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130-134 °C(lit.) |
| Boiling point: | 305.9±37.0 °C(Predicted) |
| Density | 1.4837 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| pka | 5.84±0.40(Predicted) |
| color | Clear colorless to slightly yellow |
| InChI | InChI=1S/C11H5F6NO/c12-10(13,14)6-3-1-2-5-7(19)4-8(11(15,16)17)18-9(5)6/h1-4H,(H,18,19) |
| InChIKey | JIWHKBAFGFPZKM-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2C(F)(F)F)C(O)=CC=1C(F)(F)F |
| CAS DataBase Reference | 35853-41-9(CAS DataBase Reference) |
Description and Uses
2,8-Bis(trifluoromethyl)-4-quinolinol is a simplified quinine derivative that exhibits the highest antifungal activity among its series and serves as a lead compound for further structural modification[6]. This compound acts as a starting material for synthesizing quinoline derivatives with various substitutions at the 4-OH position, including specific series such as compounds 4g–i[7-8]. It reacts with methyl chloroacetate in DMF using K2CO3 to form intermediates, and undergoes conversion to yield 4-bromo-2,8-bis(trifluoromethyl)quinoline[6].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
| REACH Registrations | Active |






