BD1551632
4-(Hydroxymethyl)-2-nitrophenol , 98% , 41833-13-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB30.40 | In Stock |
|
| 5g | RMB115.20 | In Stock |
|
| 10g | RMB210.40 | In Stock |
|
| 25g | RMB512.00 | In Stock |
|
| 100g | RMB1485.60 | In Stock |
|
| 500g | RMB7300.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-98 °C |
| Boiling point: | 298.4°C (rough estimate) |
| Density | 1.4523 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 6.97±0.14(Predicted) |
| Appearance | Yellow to brown Solid |
| InChI | InChI=1S/C7H7NO4/c9-4-5-1-2-7(10)6(3-5)8(11)12/h1-3,9-10H,4H2 |
| InChIKey | IMLGJYRKLCMJPI-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC=C(O)C([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 41833-13-0(CAS DataBase Reference) |
Description and Uses
4-Hydroxy-3-nitrobenzyl Alcohol is used in preparation of monoclonal IgG4 anti-human MET antibody and drug conjugates for cancer therapy.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338-P362+P364 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22-36 |
| Safety Statements | 36/37/39-26 |
| HazardClass | IRRITANT |
| HS Code | 2908990000 |
