A5571812
4-Methoxy-3-nitrobenzoic acid , ≥98% , 89-41-8
CAS NO.：89-41-8
Empirical Formula: C8H7NO5
Molecular Weight: 197.14
MDL number: MFCD00007256
EINECS: 201-906-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 25G | RMB97.60 | In Stock |
|
| 100G | RMB323.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192-194 °C (lit.) |
| Boiling point: | 334.23°C (rough estimate) |
| Density | 1.5023 (rough estimate) |
| vapor pressure | 0.001Pa at 20℃ |
| refractive index | 1.5700 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.85±0.10(Predicted) |
| form | Crystalline Powder |
| color | Light yellow |
| BRN | 2115073 |
| InChI | 1S/C8H7NO5/c1-14-7-3-2-5(8(10)11)4-6(7)9(12)13/h2-4H,1H3,(H,10,11) |
| InChIKey | ANXBDAFDZSXOPQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1[N+]([O-])=O)C(O)=O |
| LogP | 1.41 at 23℃ and pH6.3-6.6 |
| CAS DataBase Reference | 89-41-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 4-methoxy-3-nitro-(89-41-8) |
| EPA Substance Registry System | Benzoic acid, 4-methoxy-3-nitro- (89-41-8) |
Description and Uses
4-Methoxy-3-nitrobenzoic acid was used in the synthesis of:
- BIPHEP-1-OMe [BIHEP= (2,2′-bis(diphenylphosphino)biphenyl)], precatalyst for reductive coupling of butadiene to aldehydes
- aniline mustard analogues, having potential anti-tumor activity
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-51 |
| Safety Statements | 24/25 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
