BD1559348
Ethyl4-(2-hydroxybutan-2-yl)-2-propyl-1H-imidazole-5-carboxylate , 95% , 172875-53-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB732.80 | In Stock |
|
| 250mg | RMB1244.80 | In Stock |
|
| 1g | RMB3360.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 464.9±35.0 °C(Predicted) |
| Density | 1.111±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 12.97±0.10(Predicted) |
| form | Gel |
| color | Colourless |
| InChI | InChI=1S/C13H22N2O3/c1-5-8-9-14-10(12(16)18-7-3)11(15-9)13(4,17)6-2/h17H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | UDEWGNFXYCGRJV-UHFFFAOYSA-N |
| SMILES | C1(CCC)NC(C(OCC)=O)=C(C(O)(C)CC)N=1 |
Description and Uses
Ethyl 4-(2-Hydroxybutan-2-yl)-2-propyl-1H-imidazole-5-carboxylate is used in the synthesis of Ethyl Olmesartan Medoxomil (E925335), which is an angiotensin II receptor antagonist. Used as an anti-hypertensive.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
