BD1560132
2-Chloro-5-fluorophenol , 98% , 3827-49-4
CAS NO.：3827-49-4
Empirical Formula: C6H4ClFO
Molecular Weight: 146.55
MDL number: MFCD00042524
EINECS: 609-539-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB57.60 | In Stock |
|
| 5g | RMB118.40 | In Stock |
|
| 10g | RMB228.00 | In Stock |
|
| 25g | RMB323.20 | In Stock |
|
| 100g | RMB1256.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 183-185 °C |
| Density | 1.3675 (estimate) |
| refractive index | 1.524-1.526 |
| Flash point: | 183-185°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| pka | 7.50±0.10(Predicted) |
| color | Clear colorless to pale yellow |
| Water Solubility | slightly soluble |
| InChI | InChI=1S/C6H4ClFO/c7-5-2-1-4(8)3-6(5)9/h1-3,9H |
| InChIKey | CMQOZIKIOASEIN-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(F)=CC=C1Cl |
| CAS DataBase Reference | 3827-49-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H312-H314-H318-H401-H411 |
| Precautionary statements | P273-P280-P303+P361+P353-P305+P351+P338-P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22-22 |
| Safety Statements | 36/37/39-26 |
| RIDADR | 2810 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| HS Code | 29081990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
