BD1572632
1-(p-Tolyl)butan-1-one , 95% , 4160-52-5
CAS NO.:4160-52-5
Empirical Formula: C11H14O
Molecular Weight: 162.23
MDL number: MFCD00027139
EINECS: 223-996-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB256.00 | In Stock |
|
| 250mg | RMB409.60 | In Stock |
|
| 1g | RMB957.60 | In Stock |
|
| 5g | RMB3320.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 12℃ |
| Boiling point: | 252℃ (739 Torr) |
| Density | 0.952±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.5232 (589.3 nm 20℃) |
| Flash point: | 110.1±8.8℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Oil |
| color | Clear Colourless |
| InChI | InChI=1S/C11H14O/c1-3-4-11(12)10-7-5-9(2)6-8-10/h5-8H,3-4H2,1-2H3 |
| InChIKey | CIYAESDXUTVTAL-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(C)C=C1)(=O)CCC |
Description and Uses
4''-Methylbutyrophenone is an aryl alkyl ketone used in the quenching of chemically excited acetone phosphorescence.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |







