BD1575532
1-(p-tolyl)Pentan-1-one , 97% , 1671-77-8
CAS NO.：1671-77-8
Empirical Formula: C12H16O
Molecular Weight: 176.25
MDL number: MFCD00027237
EINECS: 216-804-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB32.80 | In Stock |
|
| 5g | RMB97.60 | In Stock |
|
| 10g | RMB148.00 | In Stock |
|
| 25g | RMB300.80 | In Stock |
|
| 100g | RMB912.80 | In Stock |
|
| 500g | RMB2747.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 17 °C |
| Boiling point: | 261 °C |
| Density | 0.943±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform; Dichloromethane; Methanol |
| form | Oil |
| color | Colorless |
| InChI | InChI=1S/C12H16O/c1-3-4-5-12(13)11-8-6-10(2)7-9-11/h6-9H,3-5H2,1-2H3 |
| InChIKey | BCVCZJADTSTKNH-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(C)C=C1)(=O)CCCC |
| CAS DataBase Reference | 1671-77-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Pentanone, 1-(4-methylphenyl)-(1671-77-8) |
Description and Uses
4’-Methylvalerophenone is a Valerophenone derivative. Valerophenone (V091450) is an aromatic ketone that is often used as a tool in the study of various photochemical processes. Valerophenone is also an inhibitor of the enzyme carbonyl reductase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2914390090 |
