BD1578632
4-Nitrobenzene-1-sulfonyl fluoride , 97% , 349-96-2
Synonym(s):
4-Nitrobenzenesulfonyl fluoride
| Pack Size | Price | Stock | Quantity |
| 1g | RMB48.80 | In Stock |
|
| 5g | RMB223.20 | In Stock |
|
| 10g | RMB412.80 | In Stock |
|
| 25g | RMB989.60 | In Stock |
|
| 100g | RMB3812.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-80 °C |
| Boiling point: | 305.1±25.0 °C(Predicted) |
| Density | 1.5663 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Crystalline Powder |
| color | Yellow |
| InChI | 1S/C6H4FNO4S/c7-13(11,12)6-3-1-5(2-4-6)8(9)10/h1-4H |
| InChIKey | HRLAPUHJWRZEIC-UHFFFAOYSA-N |
| SMILES | FS(C1=CC=C([N+]([O-])=O)C=C1)(=O)=O |
Description and Uses
Sulfonyl fluoride motif can be used as a connector for the assembly of -SO2- linked small molecules with proteins or nucleic acids. This new click chemistry approach through sulfates is a complimentary approach to using amides and phosphate groups as linkers.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 45-36/37/39-26-27 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






