BD1581632
4-Fluorobenzenesulfonamide , 98% , 402-46-0
CAS NO.:402-46-0
Empirical Formula: C6H6FNO2S
Molecular Weight: 175.18
MDL number: MFCD00025384
EINECS: 206-946-2
| Pack Size | Price | Stock | Quantity |
| 10g | RMB60.80 | In Stock |
|
| 25g | RMB141.60 | In Stock |
|
| 100g | RMB551.20 | In Stock |
|
| 500g | RMB2708.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124-127 °C (lit.) |
| Boiling point: | 307.9±44.0 °C(Predicted) |
| Density | 1.428±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 10.00±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | It is soluble in water. |
| InChI | InChI=1S/C6H6FNO2S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H,(H2,8,9,10) |
| InChIKey | LFLSATHZMYYIAQ-UHFFFAOYSA-N |
| SMILES | C1(S(N)(=O)=O)=CC=C(F)C=C1 |
| CAS DataBase Reference | 402-46-0(CAS DataBase Reference) |
Description and Uses
4-Fluorobenzenesulfonamide, is used to produce bis-(4-fluoro-benzenesulfonyl)-amine with 4-fluoro-benzenesulfonyl chloride at temperature of 55 - 60. This reaction will need reagent OH-.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xi |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 26-36-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DB2630000 |
| Hazard Note | Irritant/Toxic |
| HazardClass | IRRITANT |
| HS Code | 29350090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





