BD1582432
1-(3-(Trifluoromethyl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl)-4-(2,4,5-trifluorophenyl)butane-1,3-dione , 98% , 764667-65-4
CAS NO.:764667-65-4
Empirical Formula: C16H12F6N4O2
Molecular Weight: 406.28
MDL number: MFCD11111443
EINECS: 619-997-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB54.40 | In Stock |
|
| 5g | RMB179.20 | In Stock |
|
| 10g | RMB341.60 | In Stock |
|
| 25g | RMB717.60 | In Stock |
|
| 100g | RMB2516.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82-84°C |
| Boiling point: | 513.9±60.0 °C(Predicted) |
| Density | 1.60±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 11.44±0.20(Predicted) |
| color | Off-White to Pale Beige |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C16H12F6N4O2/c17-10-6-12(19)11(18)4-8(10)3-9(27)5-14(28)25-1-2-26-13(7-25)23-24-15(26)16(20,21)22/h4,6H,1-3,5,7H2 |
| InChIKey | QAEDTLFWHIEVPK-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1[n]2c(nn1)CN(CC2)C(=O)CC(=O)Cc3c(cc(c(c3)F)F)F |
| LogP | 2.424 |
| CAS DataBase Reference | 764667-65-4(CAS DataBase Reference) |
Description and Uses
4-Oxo-4-[3-(trifluoromethyl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl]-1-(2,4,5-trifluorophenyl)butan-2-one is a Sitagliptin intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |

![1-(3-(Trifluoromethyl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl)-4-(2,4,5-trifluorophenyl)butane-1,3-dione](https://img.chemicalbook.com/CAS/GIF/764667-65-4.gif)





