BD1584032
4-Phenoxyphthalonitrile , 97% , 38791-62-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB106.40 | In Stock |
|
| 1g | RMB266.40 | In Stock |
|
| 5g | RMB1066.40 | In Stock |
|
| 10g | RMB1865.60 | In Stock |
|
| 25g | RMB3732.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-100 °C(lit.) |
| Boiling point: | 399.8±37.0 °C(Predicted) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder, crystals or chunks |
| Appearance | Off-white to yellow Solid |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C14H8N2O/c15-9-11-6-7-14(8-12(11)10-16)17-13-4-2-1-3-5-13/h1-8H |
| InChIKey | CRZSSXUMRNESCC-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(Oc2ccccc2)cc1C#N |
Description and Uses
4-Phenoxyphthalonitrile is a C4-substituted phthalonitrile with monoamine oxidase inhibitory activity. 4-Phenoxyphthalonitrile is used in organic pigments and dyes. Dyes and metabolites.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




