PRODUCT Properties
| Melting point: | 194-197 °C (lit.) |
| Boiling point: | 435.9±37.0 °C(Predicted) |
| Density | 1.53±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 2.82±0.10(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C8H5N3S2/c9-4-12-5-1-2-6-7(3-5)13-8(10)11-6/h1-3H,(H2,10,11) |
| InChIKey | FVNSRFMQXKMHTQ-UHFFFAOYSA-N |
| SMILES | S(C1C=C2SC(N)=NC2=CC=1)C#N |
| CAS DataBase Reference | 7170-77-6(CAS DataBase Reference) |
| EPA Substance Registry System | Thiocyanic acid, 2-amino-6-benzothiazolyl ester (7170-77-6) |
Description and Uses
6-Thiocyanatobenzo[d]thiazol-2-amine is useful in the synthesis of the potent and Selective MET Kinase Inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2934208090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![6-Thiocyanatobenzo[d]thiazol-2-amine](https://img.chemicalbook.com/CAS/GIF/7170-77-6.gif)

