BD1713948
1-(2-Fluoro-6-(trifluoromethyl)phenyl)ethanone , 98% , 174013-29-7
| Pack Size | Price | Stock | Quantity |
| 100g | RMB3579.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 200.6±40.0 °C(Predicted) |
| Density | 1.326 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 187 °F |
| storage temp. | Store at room temperature |
| form | liquid |
| Specific Gravity | 1.326 |
| color | Clear, faint yellow |
| BRN | 9193675 |
| InChI | 1S/C9H6F4O/c1-5(14)8-6(9(11,12)13)3-2-4-7(8)10/h2-4H,1H3 |
| InChIKey | IYMYYQMPOBPRPU-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(F)cccc1C(F)(F)F |
| CAS DataBase Reference | 174013-29-7(CAS DataBase Reference) |
Description and Uses
2′-Fluoro-6′-(trifluoromethyl)acetophenone may be used in chemical synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Excepted Quantities | Non-Hazardous |






