BD1716648
Fmoc-Pen(Acm)-OH , 98% , 201531-76-2
CAS NO.：201531-76-2
Empirical Formula: C23H26N2O5S
Molecular Weight: 442.53
MDL number: MFCD00151935
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB296.00 | In Stock |
|
| 250mg | RMB438.40 | In Stock |
|
| 1g | RMB1088.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 709.3±60.0 °C(Predicted) |
| Density | 1.281±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| form | solid |
| pka | 3.43±0.10(Predicted) |
| InChIKey | HJXCJYNKTHOYRD-HXUWFJFHSA-N |
| SMILES | C(O)(=O)[C@H](C(SCNC(C)=O)(C)C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
Description and Uses
Fmoc-Pen(Acm)-OH is an amino acid derivative with an Fmoc protecting group that can be used to synthesize chemically modified cyclic peptides containing cell adhesion recognition (CAR) sequences[1].
Safety
| HazardClass | IRRITANT |
