M2507035
                    Fmoc-D-Pen(Trt)-OH , ≥98.5% , 201532-01-6
| Pack Size | Price | Stock | Quantity | 
| 1g | RMB279.20 | In Stock | 
                                                 | 
                                        
| 5g | RMB567.20 | In Stock | 
                                                 | 
                                        
| 25g | RMB2152.80 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Boiling point: | 768.8±60.0 °C(Predicted) | 
                                    
| Density | 1.242±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | -15°C | 
                                    
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | 
                                    
| form | Powder | 
                                    
| pka | 3.70±0.10(Predicted) | 
                                    
| color | White to off-white | 
                                    
| InChIKey | XSGMGAINOILNJR-DHUJRADRSA-N | 
                                    
| SMILES | C(O)(=O)[C@@H](C(SC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)(C)C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | 
                                    
Description and Uses
Fmoc-D-Pen(Trt)-OH is an amino acid derivative with an Fmoc protecting group, which can be used to synthesize analogs of cyclic lanthionine enkephalin, a δ-opioid receptor selective ligand[1].
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302-H315-H319-H335 | 
| Precautionary statements | P261-P305+P351+P338 | 
| HazardClass | IRRITANT | 






