BD1792348
6-(Benzyloxy)-9H-purine , 98% , 57500-07-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB124.80 | In Stock |
|
| 5g | RMB374.40 | In Stock |
|
| 25g | RMB1123.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173-175 °C (lit.) |
| Boiling point: | 414.9±55.0 °C(Predicted) |
| Density | 1.36±0.1 g/cm3(Predicted) |
| pka | 8.28±0.20(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Green |
| InChI | 1S/C12H10N4O/c1-2-4-9(5-3-1)6-17-12-10-11(14-7-13-10)15-8-16-12/h1-5,7-8H,6H2,(H,13,14,15,16) |
| InChIKey | ZZZXGPGVDJDFCJ-UHFFFAOYSA-N |
| SMILES | C(Oc1ncnc2[nH]cnc12)c3ccccc3 |
| CAS DataBase Reference | 57500-07-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![[(1S,2S,3S,5S)-5-[2-Amino-6-(benzyloxy)-9H-purin-9-yl]-3-[dimethyl(phenyl)silyl]-1-hydroxycyclopentane-1,2-diyl]dimethanol](https://img.chemicalbook.com/CAS/GIF/701278-05-9.gif)

