BD8993131
6-((4-(Aminomethyl)benzyl)oxy)-7H-purin-2-amine , 96% , 674799-96-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB350.40 | In Stock |
|
| 250mg | RMB641.60 | In Stock |
|
| 1g | RMB1661.60 | In Stock |
|
| 5g | RMB6237.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >240°C(dec.) |
| Boiling point: | 669.9±65.0 °C(Predicted) |
| Density | 1.433±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly, Heated, Sonicated), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 9.54±0.10(Predicted) |
| color | Off-White to Pale Yellow |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C13H14N6O/c14-5-8-1-3-9(4-2-8)6-20-12-10-11(17-7-16-10)18-13(15)19-12/h1-4,7H,5-6,14H2,(H3,15,16,17,18,19) |
| InChIKey | UINSGVKWAFJDPI-UHFFFAOYSA-N |
| SMILES | N1C2C(=NC(N)=NC=2OCC2=CC=C(CN)C=C2)NC=1 |
Description and Uses
A cross linker



![O6-[4-(Trifluoroacetamidomethyl)benzyl]guanine](https://img.chemicalbook.com/StructureFile/ChemBookStructure22/GIF/CB7649987.gif)


