BD1793548
Ethyl(3-Methoxybenzoyl)acetate , 98% , 27834-99-7
Synonym(s):
m-Anisoyl-acetic acid ethyl ester;Ethyl m-anisoylacetate;Ethyl 3-(3-methoxyphenyl)-3-oxopropanoate
| Pack Size | Price | Stock | Quantity |
| 1g | RMB74.40 | In Stock |
|
| 5g | RMB258.40 | In Stock |
|
| 25g | RMB876.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | >268 °C(lit.) |
| Density | 1.146 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| pka | 10.28±0.46(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | 1S/C12H14O4/c1-3-16-12(14)8-11(13)9-5-4-6-10(7-9)15-2/h4-7H,3,8H2,1-2H3 |
| InChIKey | FDPPVAYPZOORBP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1cccc(OC)c1 |
| CAS DataBase Reference | 27834-99-7(CAS DataBase Reference) |
Description and Uses
Reactant involved in:• ;Stereoselective ketonization-olefination of indoles1• ;Lewis base catalyzed hydrosilylation2 and sequential reactions3,4• ;Asymmetric hydrogenation5• ;Organocatalytic reduction by trichlorosilane6
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P261-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| WGK Germany | 3 |
| HS Code | 2918.99.4700 |
| Storage Class | 10 - Combustible liquids |
