BD1980048
(1R,2R,4S)-rel-Bicyclo[2.2.1]heptan-2-amine , 95% , 7242-92-4
CAS NO.:7242-92-4
Empirical Formula: C7H13N
Molecular Weight: 111.18
MDL number: MFCD00078132
EINECS: 230-647-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB176.00 | In Stock |
|
| 250mg | RMB264.80 | In Stock |
|
| 1g | RMB573.60 | In Stock |
|
| 5g | RMB2016.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >345 °C |
| Boiling point: | 49 °C/10 mmHg (lit.) |
| Density | 0.938 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 95 °F |
| storage temp. | 2-8°C(protect from light) |
| pka | 10.96±0.20(Predicted) |
| form | Liquid |
| color | Clear colorless to pale yellow |
| InChI | 1S/C7H13N/c8-7-4-5-1-2-6(7)3-5/h5-7H,1-4,8H2/t5-,6+,7+/m0/s1 |
| InChIKey | JEPPYVOSGKWVSJ-RRKCRQDMSA-N |
| SMILES | N[C@@H]1C[C@H]2CC[C@@H]1C2 |
Description and Uses
exo-2-Aminonorbornane is used in preparation of heterocyclic compounds as CDK kinase inhibitors for the treatment of cancer.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36/37/39 |
| RIDADR | UN 2733 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 2921309990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |

![(1R,2R,4S)-rel-Bicyclo[2.2.1]heptan-2-amine](https://img.chemicalbook.com/CAS/GIF/7242-92-4.gif)



![(CIS)-2-AMINO-3-CARBOXYBICYCLO[2.2.1]HEPTANE HYDROCHLORIDE](https://img.chemicalbook.com/CAS/GIF/14932-25-3.gif)
![3-exo-Aminobicyclo[2.2.1]heptane-2-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/88330-32-9.gif)
![Diexo-3-Amino-bicyclo[2.2.1]heptane-2-carboxylicacidethylester](https://img.chemicalbook.com/CAS/GIF/105786-35-4.gif)