BD2037148
4-Fluoro-2-(trifluoromethyl)benzene-1-sulfonylchloride , 97% , 176225-09-5
CAS NO.:176225-09-5
Empirical Formula: C7H3ClF4O2S
Molecular Weight: 262.61
MDL number: MFCD01091000
| Pack Size | Price | Stock | Quantity |
| 1g | RMB107.20 | In Stock |
|
| 5g | RMB317.60 | In Stock |
|
| 25g | RMB1255.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48-52 °C |
| Boiling point: | 76°C/0.5mm |
| Density | 1.603±0.06 g/cm3(Predicted) |
| Flash point: | >110℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Yellow to Orange |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C7H3ClF4O2S/c8-15(13,14)6-2-1-4(9)3-5(6)7(10,11)12/h1-3H |
| InChIKey | IGMYEVQPXWKFQF-UHFFFAOYSA-N |
| SMILES | Fc1ccc(c(c1)C(F)(F)F)S(Cl)(=O)=O |
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | Xi,C |
| Risk Statements | 34 |
| Safety Statements | 36/37/39-26 |
| RIDADR | UN3261 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2904990090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






