BD2046548
5-Bromo-6-chloropyridine-3-sulfonylchloride , 95% , 216394-05-7
CAS NO.：216394-05-7
Empirical Formula: C5H2BrCl2NO2S
Molecular Weight: 290.95
MDL number: MFCD01318107
EINECS: 674-555-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1704.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71-73°C |
| Boiling point: | 352.8±42.0 °C(Predicted) |
| Density | 1.973±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Dichloromethane |
| form | Solid |
| pka | -6.06±0.10(Predicted) |
| color | Pale Yellow |
| Water Solubility | Reacts with water. Soluble in dichloromethane. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C5H2BrCl2NO2S/c6-4-1-3(12(8,10)11)2-9-5(4)7/h1-2H |
| InChIKey | TURGMVYIESHZBE-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=C(Br)C=C1S(Cl)(=O)=O |
| CAS DataBase Reference | 216394-05-7(CAS DataBase Reference) |
Description and Uses
3-Bromo-2-chloropyridine-5-sulfonyl chloride is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff field.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | C,Xi |
| Risk Statements | 34-36 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3261 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2933399990 |
