BD2053648
5-Amino-2-iodopyridine , 98+% , 29958-12-1
CAS NO.：29958-12-1
Empirical Formula: C5H5IN2
Molecular Weight: 220.01
MDL number: MFCD02706663
EINECS: 624-424-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB136.80 | In Stock |
|
| 1g | RMB277.60 | In Stock |
|
| 5g | RMB1068.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 63-67 °C |
| Boiling point: | 331.8±27.0 °C(Predicted) |
| Density | 2.055±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 2.78±0.10(Predicted) |
| Appearance | Light yellow to brown Solid |
| Water Solubility | Insoluble in water. |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C5H5IN2/c6-5-2-1-4(7)3-8-5/h1-3H,7H2 |
| InChIKey | FHJURFWVUOSFQI-UHFFFAOYSA-N |
| SMILES | C1=NC(I)=CC=C1N |
| CAS DataBase Reference | 29958-12-1(CAS DataBase Reference) |
Description and Uses
Used as pharmaceutical intermediate.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H318-H335-H312-H319-H332 |
| Precautionary statements | P304+P340-P405-P501a-P261-P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41-43 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 2933399990 |
