BD2058948
Limaprost , 98+% , 74397-12-9
Synonym(s):
11α,15S-Dihydroxy-17S,20-dimethyl-9-oxo-prosta-2E,13E-dien-1-oic acid;17α,20-dimethyl-δ2-PGE1
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB2340.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 97-100° |
| Boiling point: | 550.6±50.0 °C(Predicted) |
| Density | 1.118 |
| storage temp. | -20°C |
| solubility | DMF: soluble |
| form | crystalline |
| pka | 4.78±0.10(Predicted) |
| color | White to off-white |
| InChIKey | OJZYRQPMEIEQFC-UAWLTFRCSA-N |
| SMILES | C(O)(=O)/C=C/CCCC[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O)C[C@@H](C)CCCC |
Description and Uses
Limaprost is an analog of Prostaglandin E1 with structural modifications intended to give it a prolonged half-life and greater potency. Limaprost is used as an antianginal.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300 |
| Precautionary statements | P264-P301+P310 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | UK8362500 |
