PRODUCT Properties
| Melting point: | 191-192 °C |
| Boiling point: | 515.4±50.0 °C(Predicted) |
| Density | 1.503±0.06 g/cm3(Predicted) |
| refractive index | -75 ° (C=1, EtOH) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | ethanol: soluble 25 mg/mL, clear, colorless to faintly yellow |
| form | powder to crystal |
| pka | 12.68±0.70(Predicted) |
| color | White to Almost white |
| BRN | 1291394 |
| InChI | 1S/C12H15NO7/c1-6-9(14)10(15)11(16)12(19-6)20-8-4-2-7(3-5-8)13(17)18/h2-6,9-12,14-16H,1H3/t6-,9+,10+,11-,12+/m1/s1 |
| InChIKey | YILIDCGSXCGACV-BVWHHUJWSA-N |
| SMILES | C[C@H]1O[C@@H](Oc2ccc(cc2)[N+]([O-])=O)[C@H](O)[C@@H](O)[C@H]1O |
| CAS DataBase Reference | 1226-39-7(CAS DataBase Reference) |
Description and Uses
4-Nitrophenyl beta-D-Fucopyranoside (cas# 1226-39-7) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29329900 |
| Storage Class | 11 - Combustible Solids |
