BD2158048
1-Phenylcyclohexanol , 98% , 1589-60-2
CAS NO.：1589-60-2
Empirical Formula: C12H16O
Molecular Weight: 176.25
MDL number: MFCD00021393
EINECS: 216-456-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB112.00 | In Stock |
|
| 25g | RMB436.80 | In Stock |
|
| 100g | RMB1248.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 58-62 °C |
| Boiling point: | 153 °C (20 mmHg) |
| Density | 1.0350 |
| refractive index | 1.5415 (estimate) |
| Flash point: | 153°C/20mm |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 14.49±0.20(Predicted) |
| color | White to Light yellow |
| BRN | 1818360 |
| InChI | InChI=1S/C12H16O/c13-12(9-5-2-6-10-12)11-7-3-1-4-8-11/h1,3-4,7-8,13H,2,5-6,9-10H2 |
| InChIKey | DTTDXHDYTWQDCS-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)(O)CCCCC1 |
Description and Uses
1-Phenylcyclohexanol is a general reagent used in the synthesis of A-Ring modified steroids, as well as arylcyclohexanols.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Safety Statements | 24/25 |
| RTECS | GW0699900 |
| HS Code | 2906.29.6000 |
