BD2178448
4,5-Diphenyl-1,3-dioxol-2-one , 95+% , 21240-34-6
Synonym(s):
1,2-Diphenylvinylene carbonate
CAS NO.：21240-34-6
Empirical Formula: C15H10O3
Molecular Weight: 238.24
MDL number: MFCD00005381
EINECS: 244-287-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1188.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71-75 °C(lit.) |
| Boiling point: | 366.3±52.0 °C(Predicted) |
| Density | 1.288±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| form | solid |
| Appearance | Off-white to light yellow Solid |
| BRN | 1114120 |
| InChI | 1S/C15H10O3/c16-15-17-13(11-7-3-1-4-8-11)14(18-15)12-9-5-2-6-10-12/h1-10H |
| InChIKey | SROHGOJDCAODGI-UHFFFAOYSA-N |
| SMILES | O=C1OC(=C(O1)c2ccccc2)c3ccccc3 |
| CAS DataBase Reference | 21240-34-6(CAS DataBase Reference) |
Description and Uses
4,5-Diphenyl-1,3-dioxol-2-one is used as an organic synthesis intermediates.
