BD2186648
5-Fluoroindole-3-aceticacid , 96% , 443-73-2
CAS NO.：443-73-2
Empirical Formula: C10H8FNO2
Molecular Weight: 193.17
MDL number: MFCD00056921
EINECS: 207-138-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB195.20 | In Stock |
|
| 250mg | RMB291.20 | In Stock |
|
| 1g | RMB730.40 | In Stock |
|
| 5g | RMB2551.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139-143°C |
| Boiling point: | 417.9±30.0 °C(Predicted) |
| Density | 1.446±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| pka | 4.41±0.30(Predicted) |
| form | Powder |
| color | Off-white to pink |
| InChI | 1S/C10H8FNO2/c11-7-1-2-9-8(4-7)6(5-12-9)3-10(13)14/h1-2,4-5,12H,3H2,(H,13,14) |
| InChIKey | GWLLOJBOPVNWNF-UHFFFAOYSA-N |
| SMILES | OC(=O)Cc1c[nH]c2ccc(F)cc12 |
| CAS DataBase Reference | 443-73-2(CAS DataBase Reference) |
Description and Uses
5-Fluoroindole-3-acetic Acid can be used as reactant/reagent for design, synthesis, and biol. evaluation of novel tetrahydroprotoberberine derivatives as selective α1A-adrenoceptor antagonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
