PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Boiling point: | 343.5±37.0 °C(Predicted) |
| Density | 1.404±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder |
| pka | 2.11±0.50(Predicted) |
| color | Off-white |
| InChI | 1S/C13H10F3NO3/c1-2-20-12(19)9-6-17-10-5-7(13(14,15)16)3-4-8(10)11(9)18/h3-6H,2H2,1H3,(H,17,18) |
| InChIKey | YHUWNMJUAZJACG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2cc(ccc2c1O)C(F)(F)F |
Description and Uses
Ethyl 4-Hydroxy-7-(trifluoromethyl)quinoline-3-carboxylate (CAS# 391-02-6) can be used as a potent antimicrobial agent. It can also be prepared as TRPV1 antagonist for therapy.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
