BD2194148
N-[2-Isopropylthiazol-4-ylmethyl(methyl)carbamoyl]-L-valine , 95% , 154212-61-0
CAS NO.:154212-61-0
Empirical Formula: C14H23N3O3S
Molecular Weight: 313.42
MDL number: MFCD07369527
EINECS: 680-588-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB33.60 | In Stock |
|
| 25g | RMB140.00 | In Stock |
|
| 100g | RMB496.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 532.6±40.0 °C(Predicted) |
| Density | 1.193 |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.39±0.10(Predicted) |
| color | Light Yellow to Beige |
| InChI | InChI=1S/C14H23N3O3S/c1-8(2)11(13(18)19)16-14(20)17(5)6-10-7-21-12(15-10)9(3)4/h7-9,11H,6H2,1-5H3,(H,16,20)(H,18,19)/t11-/m0/s1 |
| InChIKey | OSQWRZICKAOBFA-NSHDSACASA-N |
| SMILES | C(O)(=O)[C@H](C(C)C)NC(N(C)CC1=CSC(C(C)C)=N1)=O |
| CAS DataBase Reference | 154212-61-0(CAS DataBase Reference) |
Description and Uses
N-[[N-Methyl-N-[(2-isopropyl]-4-thiazolyl)methyl)amino]carbonyl-L-valine Carboxylic Acid (Ritonavir EP Impurity A) is an intermediate in the synthesis of Ritonavir.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |

![N-[2-Isopropylthiazol-4-ylmethyl(methyl)carbamoyl]-L-valine](https://img.chemicalbook.com/CAS/GIF/154212-61-0.gif)



