BD2214048
3-(Difluoromethoxy)benzene-1-sulfonylchloride , 98% , 351003-38-8
CAS NO.:351003-38-8
Empirical Formula: C7H5ClF2O3S
Molecular Weight: 242.63
MDL number: MFCD03094157
| Pack Size | Price | Stock | Quantity |
| 10g | RMB1046.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 233-234 °C (lit.) |
| Density | 1.509 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 208 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Oil |
| color | Colourless to Pale Yellow |
| Stability: | Hygroscopic, Moisture Sensitive |
| InChI | 1S/C7H5ClF2O3S/c8-14(11,12)6-3-1-2-5(4-6)13-7(9)10/h1-4,7H |
| InChIKey | VKSMJFRQQMGYHS-UHFFFAOYSA-N |
| SMILES | FC(F)Oc1cccc(c1)S(Cl)(=O)=O |
Description and Uses
3-(Difluoromethoxy)benzenesulfonyl Chloride is a useful reagent for the preparation of phenoxypyridylpyrimidine derivatives as inositol requiring enzyme 1 (IRE1) activity modulators.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 22-26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HS Code | 2909309090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |







