BD2271448
5-Chloro-2,4-difluoropyrimidine , 98% , 25151-07-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB125.60 | In Stock |
|
| 250mg | RMB189.60 | In Stock |
|
| 1g | RMB464.00 | In Stock |
|
| 5g | RMB1557.60 | In Stock |
|
| 25g | RMB6690.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 250.6±43.0 °C(Predicted) |
| Density | 1.563±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -3.94±0.29(Predicted) |
| form | liquid |
| color | Colourless |
| InChI | InChI=1S/C4HClF2N2/c5-2-1-8-4(7)9-3(2)6/h1H |
| InChIKey | XZSZSTCLQANXKU-UHFFFAOYSA-N |
| SMILES | C1(F)=NC=C(Cl)C(F)=N1 |
Description and Uses
5-Chloro-2,4-difluoropyrimidine is a synthetic intermediate in various synthesis of pharmaceutical goods.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P411+P235-P280-P305+P351+P338 |
| HazardClass | IRRITANT |
| HS Code | 2920907090 |
