BD2327348
Ethyl3-(adamantan-1-yl)-3-oxopropanoate , 95+% , 19386-06-2
CAS NO.：19386-06-2
Empirical Formula: C15H22O3
Molecular Weight: 250.33
MDL number: MFCD00074741
EINECS: 243-011-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1164.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108-110℃ |
| Boiling point: | 108-110 °C0.06 mm Hg(lit.) |
| Density | 1.037 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 10.63±0.20(Predicted) |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| InChI | 1S/C15H22O3/c1-2-18-14(17)6-13(16)15-7-10-3-11(8-15)5-12(4-10)9-15/h10-12H,2-9H2,1H3/t10-,11+,12-,15- |
| InChIKey | FOISHGXCIBGQJU-WUQLGEGHSA-N |
| SMILES | CCOC(=O)CC(=O)C12C[C@H]3C[C@H](C[C@H](C3)C1)C2 |
Description and Uses
Ethyl 3-(1-adamantyl)-3-oxopropionate may be used in chemical synthesis studies.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| Storage Class | 10 - Combustible liquids |
