PRODUCT Properties
| Melting point: | 168-170 °C |
| alpha | [α]D20 -2～+2° (c=1, H2O) |
| Boiling point: | 588.7±45.0 °C(Predicted) |
| Density | 1.346±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Acetic Acid (Slightly, Heated, Sonicated), DMSO (Slightly), Water (Slightly, Heated) |
| pka | 3.45±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| BRN | 1726196 |
| Major Application | peptide synthesis |
| InChI | 1S/C6H10N2O4/c1-3(9)8-4(6(11)12)2-5(7)10/h4H,2H2,1H3,(H2,7,10)(H,8,9)(H,11,12)/t4-/m0/s1 |
| InChIKey | HXFOXFJUNFFYMO-BYPYZUCNSA-N |
| SMILES | CC(=O)N[C@@H](CC(N)=O)C(O)=O |
| CAS DataBase Reference | 4033-40-3(CAS DataBase Reference) |
Description and Uses
N2-Acetyl-L-asparagine is a reagent in the synthesis of three mer peptide pENW (pGlu-Asn-Trp) derivatives as antiplatelet aggregation pharmaceuticals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| Storage Class | 11 - Combustible Solids |
