PRODUCT Properties
| Melting point: | 125-126°C |
| Boiling point: | 100-102 °C(Press: 0.2 Torr) |
| Density | 1.170±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Water (Slightly) |
| form | Solid |
| pka | 3.69±0.10(Predicted) |
| color | White to Off-White |
| optical activity | Consistent with structure |
| BRN | 1722932 |
| InChI | InChI=1S/C5H9NO3/c1-3(5(8)9)6-4(2)7/h3H,1-2H3,(H,6,7)(H,8,9)/t3-/m0/s1 |
| InChIKey | KTHDTJVBEPMMGL-VKHMYHEASA-N |
| SMILES | C(O)(=O)[C@H](C)NC(C)=O |
| CAS DataBase Reference | 97-69-8(CAS DataBase Reference) |
| NIST Chemistry Reference | L-Alanine, N-acetyl-(97-69-8) |
Description and Uses
2-Acetylaminopropionic acid is used as a biomarker for prostate cancer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29241990 |







