A0666812
N-Acetyl-L-Valine , 98% , 96-81-1
Synonym(s):
N-α-Acetyl-L -valine;N-Acyl-Valine
CAS NO.:96-81-1
Empirical Formula: C7H13NO3
Molecular Weight: 159.18
MDL number: MFCD00066066
EINECS: 202-537-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB56.80 | In Stock |
|
| 100G | RMB223.20 | In Stock |
|
| 500G | RMB639.20 | In Stock |
|
| 2.5kg | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163-167℃ |
| alpha | [α]D20 -16~-20゜ (c=5, C2H5OH) |
| Boiling point: | 362.2±25.0 °C(Predicted) |
| Density | 1.094±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| pka | 3.62±0.10(Predicted) |
| color | White |
| optical activity | -18° (C=0.01 g/ml, H2O) |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H13NO3/c1-4(2)6(7(10)11)8-5(3)9/h4,6H,1-3H3,(H,8,9)(H,10,11)/t6-/m0/s1 |
| InChIKey | IHYJTAOFMMMOPX-LURJTMIESA-N |
| SMILES | C(O)(=O)[C@H](C(C)C)NC(C)=O |
| CAS DataBase Reference | 96-81-1(CAS DataBase Reference) |
| NIST Chemistry Reference | L-valine, n-acetyl-(96-81-1) |
Description and Uses
Ac-Val-OH may be employed as a ligand for the meta-selective tert-alkylation reaction.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36-43 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |






