BD2421648
4-Amino-N,N-dimethylbenzenesulfonamide , 98% , 1709-59-7
CAS NO.:1709-59-7
Empirical Formula: C8H12N2O2S
Molecular Weight: 200.26
MDL number: MFCD00031428
EINECS: 216-970-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB117.60 | In Stock |
|
| 1g | RMB239.20 | In Stock |
|
| 5g | RMB1038.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-172°C |
| Boiling point: | 352.9±44.0 °C(Predicted) |
| Density | 1.2581 (rough estimate) |
| refractive index | 1.5690 (estimate) |
| storage temp. | 2-8°C(protect from light) |
| pka | pKa 2.11(H2O
t = 25
I = 0.05) (Uncertain) |
| form | solid |
| Appearance | Off-white to brown Solid |
| Water Solubility | 626.8mg/L(37 ºC) |
| InChI | 1S/C8H12N2O2S/c1-10(2)13(11,12)8-5-3-7(9)4-6-8/h3-6H,9H2,1-2H3 |
| InChIKey | BABGMPQXLCJMSK-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)c1ccc(N)cc1 |
| CAS DataBase Reference | 1709-59-7(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonamide, 4-amino-N,N-dimethyl- (1709-59-7) |
Description and Uses
N,N-Dimethyl 4-aminobenzenesulfonamide
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-43-22 |
| Safety Statements | 26-36/37/39-36/37 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 2935909099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |





![DBD-PZ [=4-(N,N-Dimethylaminosulfonyl)-7-piperazino-2,1,3-benzoxadiazole] [for HPLC Labeling]](https://img.chemicalbook.com/CAS/GIF/139332-64-2.gif)
![DBD-COCl [=4-(<i>N</i>,<i>N</i>-Dimethylaminosulfonyl)-7-(<i>N</i>-chloroformylmethyl-<i>N</i>-methylamino)-2,1,3-benzoxadiazole] [for HPLC Labeling]](https://img.chemicalbook.com/CAS/GIF/156153-43-4.gif)
![DBD-H [=4-(<i>N</i>,<i>N</i>-Dimethylaminosulfonyl)-7-hydrazino-2,1,3-benzoxadiazole] [for HPLC Labeling]](https://img.chemicalbook.com/CAS/GIF/131467-86-2.gif)