PRODUCT Properties
| Melting point: | 193-194° |
| Boiling point: | 538.1±60.0 °C(Predicted) |
| Density | 1.3541 (rough estimate) |
| refractive index | 1.6320 (estimate) |
| pka | -0.17±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| Water Solubility | 80mg/L(37 ºC) |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C13H15N3O4S/c1-8-9(2)15-20-13(8)16(10(3)17)21(18,19)12-6-4-11(14)5-7-12/h4-7H,14H2,1-3H3 |
| InChIKey | JFNWFXVFBDDWCX-UHFFFAOYSA-N |
| SMILES | [S](=O)(=O)(N(c2[o]nc(c2C)C)C(=O)C)c1ccc(cc1)N |
Description and Uses
Sulfisoxazole Acetyl is an antibiotic used in the prevention of infection especially when used in conjunction with erythromycin.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352-P304+P340+P312-P305+P351+P338-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| WGK Germany | WGK 3 |
| HS Code | 2935904000 |
| Storage Class | 11 - Combustible Solids |
