BD2426048
1-(4-(Trifluoromethyl)phenyl)thiourea , 97% , 1736-72-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB280.00 | In Stock |
|
| 5g | RMB834.40 | In Stock |
|
| 25g | RMB2510.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142-146 °C |
| Boiling point: | 269.9±50.0 °C(Predicted) |
| Density | 1.457±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.33±0.70(Predicted) |
| color | Off-White to Pale Brown |
| BRN | 2695479 |
| InChI | 1S/C8H7F3N2S/c9-8(10,11)5-1-3-6(4-2-5)13-7(12)14/h1-4H,(H3,12,13,14) |
| InChIKey | OWTDDZMFRLUBQI-UHFFFAOYSA-N |
| SMILES | NC(=S)Nc1ccc(cc1)C(F)(F)F |
| CAS DataBase Reference | 1736-72-7(CAS DataBase Reference) |
Description and Uses
[4-(Trifluoromethyl)phenyl]thiourea is a reagent used in the synthesis of pharmaceuticals such as thiourea analogs as inhibitors of UT-A and UT-B transporters as well as 2-aminothiazole sphingosine inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36/37 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2930909899 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |



![1-METHYL-5-(TRIFLUOROMETHYL)-2,3-DIHYDRO-1H-BENZO[D]IMIDAZOLE-2-THIONE](https://img.chemicalbook.com/CAS/GIF/7341-87-9.gif)
![4-[4-(Trifluoromethyl)phenyl]-3-thiosemicarbazide](https://img.chemicalbook.com/CAS/GIF/206761-90-2.gif)

