BD2467848
1-Phenyl-2,5,8,11,14,17,20,23-octaoxapentacosan-25-ol , 95% , 477775-73-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB105.60 | In Stock |
|
| 250mg | RMB160.80 | In Stock |
|
| 1g | RMB401.60 | In Stock |
|
| 5g | RMB1980.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 541.6±45.0 °C(Predicted) |
| Density | 1.101±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Liquid |
| pka | 14.36±0.10(Predicted) |
| color | Colorless to light yellow |
| InChI | InChI=1S/C23H40O9/c24-6-7-25-8-9-26-10-11-27-12-13-28-14-15-29-16-17-30-18-19-31-20-21-32-22-23-4-2-1-3-5-23/h1-5,24H,6-22H2 |
| InChIKey | KFJXPXAFUAPRSZ-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1)OCCOCCOCCOCCOCCOCCOCCOCCO |
Description and Uses
Octaethylene glycol monobenzyl ether (CAS 477775-73-8), also known as benzyl-PEG8-alcohol, benzyl-PEG8-OH, BnO-PEG8-OH and benzyl-PEG8-alcohol, is a PEG linker. Its structure features a benzyl protecting group (which can be deprotected under catalytic hydrogenation conditions) and a primary hydroxyl group. This primary hydroxyl group is reactive and allows for further derivatisation of the compound. The PEG9 linker enhances the water solubility of the compound.
Benzyl-PEG8-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |






