1-Phenyl-2,5,8,11,14,17-hexaoxanonadecan-19-ol , 98% , 24342-68-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB86.40 | In Stock |
|
| 250mg | RMB132.00 | In Stock |
|
| 1g | RMB334.40 | In Stock |
|
| 5g | RMB1173.60 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Boiling point: | 473.6±40.0 °C(Predicted) |
| Density | 1.097±0.06 g/cm3(Predicted) |
| refractive index | 1.4920 to 1.4960 |
| storage temp. | Storage temp. 2-8°C |
| solubility | Soluble in DMSO, DCM, DMF |
| pka | 14.36±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C19H32O7/c20-6-7-21-8-9-22-10-11-23-12-13-24-14-15-25-16-17-26-18-19-4-2-1-3-5-19/h1-5,20H,6-18H2 |
| InChIKey | VVBQKDDPSXBMMZ-UHFFFAOYSA-N |
| SMILES | C(O)COCCOCCOCCOCCOCCOCC1=CC=CC=C1 |
| CAS DataBase Reference | 24342-68-5 |
Description and Uses
Benzyl-PEG7-alcohol is a PEG chain containing a benzyl protecing group and a primary alcohol group. The benzyl is an alcohol protecting group and can be removed via hydrogenolysis. The alcohol group can react to further derivatize the compound. The hydrophilic PEG chains increase the water solubility of the compound in aqueous media. Longer PEG chains have better water solubility properties relative to shorter PEG chains.
BnO-PEG6-OH is a non-cleavable 6 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). BnO-PEG6-OH is also a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1][2].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| HS Code | 2909.30.6000 |






